About 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid
4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid (PubChem CID 80537049) has the molecular formula C14H17F2NO3S
and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid.
Molecular Properties
| Compound Name | 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid |
| PubChem CID | 80537049 |
| Molecular Formula | C14H17F2NO3S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid |
| SMILES | CC(CCNC(=O)CCSc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C14H17F2NO3S/c1-9(14(19)20)4-6-17-13(18)5-7-21-10-2-3-11(15)12(16)8-10/h2-3,8-9H,4-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | XHVRXRDSVAQGME-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid?
The IUPAC name of 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid (CID 80537049) is 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid.
What is the SMILES notation for 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid?
The canonical SMILES for 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid is CC(CCNC(=O)CCSc1ccc(F)c(F)c1)C(=O)O.
What is the InChIKey of 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid?
The InChIKey is XHVRXRDSVAQGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3S/c1-9(14(19)20)4-6-17-13(18)5-7-21-10-2-3-11(15)12(16)8-10/h2-3,8-9H,4-7H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid?
4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid has a molecular weight of 317.36 g/mol, XLogP of 2.67, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3,4-difluorophenyl)sulfanylpropanoylamino]-2-methylbutanoic acid is sourced from PubChem (CID 80537049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).