C10H8F2N2OS — CID 79195397
N-cyano-3-(3,4-difluorophenyl)sulfanylpropanamide (PubChem CID 79195397) has the molecular formula C10H8F2N2OS and a molecular weight of 242.25 g/mol. Its IUPAC name is N-cyano-3-(3,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | N-cyano-3-(3,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 79195397 |
| Molecular Formula | C10H8F2N2OS |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | N-cyano-3-(3,4-difluorophenyl)sulfanylpropanamide |
| SMILES | N#CNC(=O)CCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H8F2N2OS/c11-8-2-1-7(5-9(8)12)16-4-3-10(15)14-6-13/h1-2,5H,3-4H2,(H,14,15) |
| InChIKey | LOCUBXRKFKGUAI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|