C11H10F5NO2S — CID 81343596
3-(3,4-difluorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 81343596) has the molecular formula C11H10F5NO2S and a molecular weight of 315.26 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | 3-(3,4-difluorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 81343596 |
| Molecular Formula | C11H10F5NO2S |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCSc1ccc(F)c(F)c1)NOCC(F)(F)F |
| InChI | InChI=1S/C11H10F5NO2S/c12-8-2-1-7(5-9(8)13)20-4-3-10(18)17-19-6-11(14,15)16/h1-2,5H,3-4,6H2,(H,17,18) |
| InChIKey | WIIIMEVCOCSREN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|