C14H17F2NOS — CID 115627698
3-(3,4-difluorophenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide (PubChem CID 115627698) has the molecular formula C14H17F2NOS and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide.
| Compound Name | 3-(3,4-difluorophenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide |
|---|---|
| PubChem CID | 115627698 |
| Molecular Formula | C14H17F2NOS |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanyl-N-[(E)-pent-3-enyl]propanamide |
| SMILES | C/C=C/CCNC(=O)CCSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H17F2NOS/c1-2-3-4-8-17-14(18)7-9-19-11-5-6-12(15)13(16)10-11/h2-3,5-6,10H,4,7-9H2,1H3,(H,17,18)/b3-2+ |
| InChIKey | VQDLQPRDDYZOLP-NSCUHMNNSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|