C13H15Cl2NOS — CID 115628169
2-(2,5-dichlorophenyl)sulfanyl-N-[(E)-pent-3-enyl]acetamide (PubChem CID 115628169) has the molecular formula C13H15Cl2NOS and a molecular weight of 304.24 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[(E)-pent-3-enyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[(E)-pent-3-enyl]acetamide |
|---|---|
| PubChem CID | 115628169 |
| Molecular Formula | C13H15Cl2NOS |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[(E)-pent-3-enyl]acetamide |
| SMILES | C/C=C/CCNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NOS/c1-2-3-4-7-16-13(17)9-18-12-8-10(14)5-6-11(12)15/h2-3,5-6,8H,4,7,9H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | HYMQAZXRFBPMHL-NSCUHMNNSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|