C15H21Cl2N3OS — CID 119392216
2-(2,5-dichlorophenyl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide (PubChem CID 119392216) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 119392216 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)NCCCN1CCNCC1 |
| InChI | InChI=1S/C15H21Cl2N3OS/c16-12-2-3-13(17)14(10-12)22-11-15(21)19-4-1-7-20-8-5-18-6-9-20/h2-3,10,18H,1,4-9,11H2,(H,19,21) |
| InChIKey | YXXACGSTONWXQK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|