C19H24ClN3OS — CID 119391126
2-(8-chloronaphthalen-1-yl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide (PubChem CID 119391126) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is 2-(8-chloronaphthalen-1-yl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(8-chloronaphthalen-1-yl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 119391126 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-(8-chloronaphthalen-1-yl)sulfanyl-N-(3-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)NCCCN1CCNCC1 |
| InChI | InChI=1S/C19H24ClN3OS/c20-16-6-1-4-15-5-2-7-17(19(15)16)25-14-18(24)22-8-3-11-23-12-9-21-10-13-23/h1-2,4-7,21H,3,8-14H2,(H,22,24) |
| InChIKey | XTODMZODZNJCLN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|