C19H15Cl2NOS — CID 2679594
2-(8-chloronaphthalen-1-yl)sulfanyl-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 2679594) has the molecular formula C19H15Cl2NOS and a molecular weight of 376.31 g/mol. Its IUPAC name is 2-(8-chloronaphthalen-1-yl)sulfanyl-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(8-chloronaphthalen-1-yl)sulfanyl-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2679594 |
| Molecular Formula | C19H15Cl2NOS |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2-(8-chloronaphthalen-1-yl)sulfanyl-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H15Cl2NOS/c20-15-8-2-1-5-14(15)11-22-18(23)12-24-17-10-4-7-13-6-3-9-16(21)19(13)17/h1-10H,11-12H2,(H,22,23) |
| InChIKey | MWWTYKVKIUDGGT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |