C20H16ClN3OS — CID 112791105
N-(1H-benzimidazol-2-ylmethyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide (PubChem CID 112791105) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 112791105 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H16ClN3OS/c21-14-7-3-5-13-6-4-10-17(20(13)14)26-12-19(25)22-11-18-23-15-8-1-2-9-16(15)24-18/h1-10H,11-12H2,(H,22,25)(H,23,24) |
| InChIKey | YIMOVDWNJSQOQG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |