C13H20Cl4N2S — CID 131880724
1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazine;dihydrochloride (PubChem CID 131880724) has the molecular formula C13H20Cl4N2S and a molecular weight of 378.20 g/mol. Its IUPAC name is 1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazine;dihydrochloride.
| Compound Name | 1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 131880724 |
| Molecular Formula | C13H20Cl4N2S |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(Cl)c(SCCCN2CCNCC2)c1 |
| InChI | InChI=1S/C13H18Cl2N2S.2ClH/c14-11-2-3-12(15)13(10-11)18-9-1-6-17-7-4-16-5-8-17;;/h2-3,10,16H,1,4-9H2;2*1H |
| InChIKey | JCJSOXJNHGMMCV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|