C13H19Cl3N2S — CID 5351639
1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazin-1-ium chloride (PubChem CID 5351639) has the molecular formula C13H19Cl3N2S and a molecular weight of 341.74 g/mol. Its IUPAC name is 1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazin-1-ium chloride.
| Compound Name | 1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazin-1-ium chloride |
|---|---|
| PubChem CID | 5351639 |
| Molecular Formula | C13H19Cl3N2S |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 1-[3-(2,5-dichlorophenyl)sulfanylpropyl]piperazin-1-ium chloride |
| SMILES | Clc1ccc(Cl)c(SCCC[NH+]2CCNCC2)c1.[Cl-] |
| InChI | InChI=1S/C13H18Cl2N2S.ClH/c14-11-2-3-12(15)13(10-11)18-9-1-6-17-7-4-16-5-8-17;/h2-3,10,16H,1,4-9H2;1H |
| InChIKey | YGMSHKYSIZQLAT-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|