C12H14Cl2N2S2 — CID 8875396
2-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 8875396) has the molecular formula C12H14Cl2N2S2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 8875396 |
| Molecular Formula | C12H14Cl2N2S2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | Clc1ccc(Cl)c(SCCSC2=NCCCN2)c1 |
| InChI | InChI=1S/C12H14Cl2N2S2/c13-9-2-3-10(14)11(8-9)17-6-7-18-12-15-4-1-5-16-12/h2-3,8H,1,4-7H2,(H,15,16) |
| InChIKey | FVWQQHJBRQVBRJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|