C11H15Cl2NS2 — CID 66218948
1-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]propan-2-amine (PubChem CID 66218948) has the molecular formula C11H15Cl2NS2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]propan-2-amine.
| Compound Name | 1-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]propan-2-amine |
|---|---|
| PubChem CID | 66218948 |
| Molecular Formula | C11H15Cl2NS2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 1-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]propan-2-amine |
| SMILES | CC(N)CSCCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2NS2/c1-8(14)7-15-4-5-16-11-6-9(12)2-3-10(11)13/h2-3,6,8H,4-5,7,14H2,1H3 |
| InChIKey | JYXDYXYDLGEPDK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|