C9H11Cl2NS — CID 104889169
(2R)-1-(2,5-dichlorophenyl)sulfanylpropan-2-amine (PubChem CID 104889169) has the molecular formula C9H11Cl2NS and a molecular weight of 236.17 g/mol. Its IUPAC name is (2R)-1-(2,5-dichlorophenyl)sulfanylpropan-2-amine.
| Compound Name | (2R)-1-(2,5-dichlorophenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 104889169 |
| Molecular Formula | C9H11Cl2NS |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | (2R)-1-(2,5-dichlorophenyl)sulfanylpropan-2-amine |
| SMILES | C[C@@H](N)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H11Cl2NS/c1-6(12)5-13-9-4-7(10)2-3-8(9)11/h2-4,6H,5,12H2,1H3/t6-/m1/s1 |
| InChIKey | BSIHZWCZDXRWOO-ZCFIWIBFSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |