C12H17Cl2NS — CID 64621822
1-(2,5-dichlorophenyl)sulfanyl-N-propylpropan-2-amine (PubChem CID 64621822) has the molecular formula C12H17Cl2NS and a molecular weight of 278.25 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfanyl-N-propylpropan-2-amine.
| Compound Name | 1-(2,5-dichlorophenyl)sulfanyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 64621822 |
| Molecular Formula | C12H17Cl2NS |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfanyl-N-propylpropan-2-amine |
| SMILES | CCCNC(C)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H17Cl2NS/c1-3-6-15-9(2)8-16-12-7-10(13)4-5-11(12)14/h4-5,7,9,15H,3,6,8H2,1-2H3 |
| InChIKey | OYJBNDHVRXMKRD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |