C14H19Cl2NO2S — CID 122099941
(2S,3S)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylpentanoic acid (PubChem CID 122099941) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is (2S,3S)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 122099941 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (2S,3S)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCCSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H19Cl2NO2S/c1-3-9(2)13(14(18)19)17-6-7-20-12-8-10(15)4-5-11(12)16/h4-5,8-9,13,17H,3,6-7H2,1-2H3,(H,18,19)/t9-,13-/m0/s1 |
| InChIKey | BHYDODGBAHMUMG-ZANVPECISA-N |
| XLogP | 4.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|