C13H17Cl2NO2S — CID 43468457
2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylbutanoic acid (PubChem CID 43468457) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylbutanoic acid.
| Compound Name | 2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43468457 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)sulfanylethylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NCCSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-8(2)12(13(17)18)16-5-6-19-11-7-9(14)3-4-10(11)15/h3-4,7-8,12,16H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | XPEYRSNYXOIWAK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|