C11H13Cl2NO2S — CID 83194055
(2R)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]propanoic acid (PubChem CID 83194055) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is (2R)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]propanoic acid.
| Compound Name | (2R)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]propanoic acid |
|---|---|
| PubChem CID | 83194055 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | (2R)-2-[2-(2,5-dichlorophenyl)sulfanylethylamino]propanoic acid |
| SMILES | C[C@@H](NCCSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H13Cl2NO2S/c1-7(11(15)16)14-4-5-17-10-6-8(12)2-3-9(10)13/h2-3,6-7,14H,4-5H2,1H3,(H,15,16)/t7-/m1/s1 |
| InChIKey | FDQLSMGWRIRGBP-SSDOTTSWSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|