C14H17Cl2NO3S — CID 43238522
2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-4-methylpentanoic acid (PubChem CID 43238522) has the molecular formula C14H17Cl2NO3S and a molecular weight of 350.27 g/mol. Its IUPAC name is 2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 43238522 |
| Molecular Formula | C14H17Cl2NO3S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)CSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO3S/c1-8(2)5-11(14(19)20)17-13(18)7-21-12-6-9(15)3-4-10(12)16/h3-4,6,8,11H,5,7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | FQTVIDBYAQNDSI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |