4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid

C11H13Cl2NO2S — CID 63033407

IUPAC4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid
SMILESCNC(CCSc1cc(Cl)ccc1Cl)C(=O)O
InChIInChI=1S/C11H13Cl2NO2S/c1-14-9(11(15)16)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9,14H,4-5H2,1H3,(H,15,16)
InChIKeyPMAVQIYPTGEFIR-UHFFFAOYSA-N
MW294.20 g/mol
LogP3.15
Rot. Bonds6

About 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid

4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid (PubChem CID 63033407) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid.

Molecular Properties

Compound Name4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid
PubChem CID63033407
Molecular FormulaC11H13Cl2NO2S
Molecular Weight294.20 g/mol
Exact Mass293.00
IUPAC Name4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid
SMILESCNC(CCSc1cc(Cl)ccc1Cl)C(=O)O
InChIInChI=1S/C11H13Cl2NO2S/c1-14-9(11(15)16)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9,14H,4-5H2,1H3,(H,15,16)
InChIKeyPMAVQIYPTGEFIR-UHFFFAOYSA-N
XLogP3.15
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.20
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid?
The IUPAC name of 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid (CID 63033407) is 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid.
What is the SMILES notation for 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid?
The canonical SMILES for 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid is CNC(CCSc1cc(Cl)ccc1Cl)C(=O)O.
What is the InChIKey of 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid?
The InChIKey is PMAVQIYPTGEFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO2S/c1-14-9(11(15)16)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9,14H,4-5H2,1H3,(H,15,16).
What are the key properties of 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid?
4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid has a molecular weight of 294.20 g/mol, XLogP of 3.15, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid is sourced from PubChem (CID 63033407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).