C11H13Cl2NO2S — CID 63033407
4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid (PubChem CID 63033407) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid.
| Compound Name | 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 63033407 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfanyl-2-(methylamino)butanoic acid |
| SMILES | CNC(CCSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H13Cl2NO2S/c1-14-9(11(15)16)4-5-17-10-6-7(12)2-3-8(10)13/h2-3,6,9,14H,4-5H2,1H3,(H,15,16) |
| InChIKey | PMAVQIYPTGEFIR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |