C13H16Cl2O2S2 — CID 66115350
methyl 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoate (PubChem CID 66115350) has the molecular formula C13H16Cl2O2S2 and a molecular weight of 339.31 g/mol. Its IUPAC name is methyl 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoate.
| Compound Name | methyl 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 66115350 |
| Molecular Formula | C13H16Cl2O2S2 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | methyl 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CSCCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2O2S2/c1-9(13(16)17-2)8-18-5-6-19-12-7-10(14)3-4-11(12)15/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | YYRFWMYGIIPNLK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|