C14H16ClNO4S — CID 66115353
methyl 3-[2-[(4-chlorobenzoyl)amino]-2-oxoethyl]sulfanyl-2-methylpropanoate (PubChem CID 66115353) has the molecular formula C14H16ClNO4S and a molecular weight of 329.81 g/mol. Its IUPAC name is methyl 3-[2-[(4-chlorobenzoyl)amino]-2-oxoethyl]sulfanyl-2-methylpropanoate.
| Compound Name | methyl 3-[2-[(4-chlorobenzoyl)amino]-2-oxoethyl]sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 66115353 |
| Molecular Formula | C14H16ClNO4S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | methyl 3-[2-[(4-chlorobenzoyl)amino]-2-oxoethyl]sulfanyl-2-methylpropanoate |
| SMILES | COC(=O)C(C)CSCC(=O)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO4S/c1-9(14(19)20-2)7-21-8-12(17)16-13(18)10-3-5-11(15)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,16,17,18) |
| InChIKey | CONNBIUUBJBBJE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |