C11H12Cl2O3S — CID 111753440
methyl (3R)-4-(2,5-dichlorophenyl)sulfanyl-3-hydroxybutanoate (PubChem CID 111753440) has the molecular formula C11H12Cl2O3S and a molecular weight of 295.19 g/mol. Its IUPAC name is methyl (3R)-4-(2,5-dichlorophenyl)sulfanyl-3-hydroxybutanoate.
| Compound Name | methyl (3R)-4-(2,5-dichlorophenyl)sulfanyl-3-hydroxybutanoate |
|---|---|
| PubChem CID | 111753440 |
| Molecular Formula | C11H12Cl2O3S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | methyl (3R)-4-(2,5-dichlorophenyl)sulfanyl-3-hydroxybutanoate |
| SMILES | COC(=O)C[C@@H](O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl2O3S/c1-16-11(15)5-8(14)6-17-10-4-7(12)2-3-9(10)13/h2-4,8,14H,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | NJKZGNFBMLRPGA-MRVPVSSYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |