C14H19Cl2NO2S — CID 103771516
2-(2,5-dichlorophenyl)sulfanyl-N-(2-hydroxy-4-methylpentyl)acetamide (PubChem CID 103771516) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(2-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 103771516 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-hydroxy-4-methylpentyl)acetamide |
| SMILES | CC(C)CC(O)CNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2S/c1-9(2)5-11(18)7-17-14(19)8-20-13-6-10(15)3-4-12(13)16/h3-4,6,9,11,18H,5,7-8H2,1-2H3,(H,17,19) |
| InChIKey | DDPAWQLNDSOIBT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |