C11H14ClNO3S — CID 66176005
2-(2-chlorophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide (PubChem CID 66176005) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide |
|---|---|
| PubChem CID | 66176005 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide |
| SMILES | O=C(CSc1ccccc1Cl)NCC(O)CO |
| InChI | InChI=1S/C11H14ClNO3S/c12-9-3-1-2-4-10(9)17-7-11(16)13-5-8(15)6-14/h1-4,8,14-15H,5-7H2,(H,13,16) |
| InChIKey | ZEMSMPVFXYGGDM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |