C11H14BrNO3S — CID 66176868
2-(4-bromophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide (PubChem CID 66176868) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide |
|---|---|
| PubChem CID | 66176868 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(2,3-dihydroxypropyl)acetamide |
| SMILES | O=C(CSc1ccc(Br)cc1)NCC(O)CO |
| InChI | InChI=1S/C11H14BrNO3S/c12-8-1-3-10(4-2-8)17-7-11(16)13-5-9(15)6-14/h1-4,9,14-15H,5-7H2,(H,13,16) |
| InChIKey | NNINDRTVMRXVEE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |