C11H13BrN2O3S — CID 106165984
3-[[2-(4-bromophenyl)sulfanylacetyl]amino]-2-hydroxypropanamide (PubChem CID 106165984) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is 3-[[2-(4-bromophenyl)sulfanylacetyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[2-(4-bromophenyl)sulfanylacetyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106165984 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 3-[[2-(4-bromophenyl)sulfanylacetyl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC(=O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrN2O3S/c12-7-1-3-8(4-2-7)18-6-10(16)14-5-9(15)11(13)17/h1-4,9,15H,5-6H2,(H2,13,17)(H,14,16) |
| InChIKey | PLGALLZSRDTSKV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |