C6H12N2O3S — CID 106164287
2-hydroxy-3-[(2-methylsulfanylacetyl)amino]propanamide (PubChem CID 106164287) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-methylsulfanylacetyl)amino]propanamide.
| Compound Name | 2-hydroxy-3-[(2-methylsulfanylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 106164287 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-hydroxy-3-[(2-methylsulfanylacetyl)amino]propanamide |
| SMILES | CSCC(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C6H12N2O3S/c1-12-3-5(10)8-2-4(9)6(7)11/h4,9H,2-3H2,1H3,(H2,7,11)(H,8,10) |
| InChIKey | ABNYPNMLUUUOPT-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |