C10H21NO2S — CID 103722907
N-[2-(2-hydroxyethyl)pentyl]-2-methylsulfanylacetamide (PubChem CID 103722907) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)pentyl]-2-methylsulfanylacetamide.
| Compound Name | N-[2-(2-hydroxyethyl)pentyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 103722907 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[2-(2-hydroxyethyl)pentyl]-2-methylsulfanylacetamide |
| SMILES | CCCC(CCO)CNC(=O)CSC |
| InChI | InChI=1S/C10H21NO2S/c1-3-4-9(5-6-12)7-11-10(13)8-14-2/h9,12H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | PBVJXYSKWPNFGC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |