C12H26N2O2 — CID 103820610
3-(dimethylamino)-N-[2-(2-hydroxyethyl)pentyl]propanamide (PubChem CID 103820610) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[2-(2-hydroxyethyl)pentyl]propanamide.
| Compound Name | 3-(dimethylamino)-N-[2-(2-hydroxyethyl)pentyl]propanamide |
|---|---|
| PubChem CID | 103820610 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-(dimethylamino)-N-[2-(2-hydroxyethyl)pentyl]propanamide |
| SMILES | CCCC(CCO)CNC(=O)CCN(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-4-5-11(7-9-15)10-13-12(16)6-8-14(2)3/h11,15H,4-10H2,1-3H3,(H,13,16) |
| InChIKey | VZGMBVZCHBWPBW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |