C10H18F3NO2 — CID 103725598
3,3,3-trifluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide (PubChem CID 103725598) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide |
|---|---|
| PubChem CID | 103725598 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3,3,3-trifluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide |
| SMILES | CCCC(CCO)CNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-2-3-8(4-5-15)7-14-9(16)6-10(11,12)13/h8,15H,2-7H2,1H3,(H,14,16) |
| InChIKey | CLWGDAWMIAPBLM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |