C11H22BrNO2 — CID 106114985
2-bromo-N-[2-(2-hydroxyethyl)pentyl]-2-methylpropanamide (PubChem CID 106114985) has the molecular formula C11H22BrNO2 and a molecular weight of 280.21 g/mol. Its IUPAC name is 2-bromo-N-[2-(2-hydroxyethyl)pentyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[2-(2-hydroxyethyl)pentyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 106114985 |
| Molecular Formula | C11H22BrNO2 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-bromo-N-[2-(2-hydroxyethyl)pentyl]-2-methylpropanamide |
| SMILES | CCCC(CCO)CNC(=O)C(C)(C)Br |
| InChI | InChI=1S/C11H22BrNO2/c1-4-5-9(6-7-14)8-13-10(15)11(2,3)12/h9,14H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | MDESGMUKPYOERB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|