C8H17N3O3 — CID 106175507
N-(3-amino-2-hydroxy-3-oxopropyl)-4-(methylamino)butanamide (PubChem CID 106175507) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-4-(methylamino)butanamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 106175507 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C8H17N3O3/c1-10-4-2-3-7(13)11-5-6(12)8(9)14/h6,10,12H,2-5H2,1H3,(H2,9,14)(H,11,13) |
| InChIKey | MRZUTHGOPOLDOD-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|