C11H13Cl2NO2S — CID 83029637
2-(2,5-dichlorophenyl)sulfanyl-N-[(2S)-2-hydroxypropyl]acetamide (PubChem CID 83029637) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[(2S)-2-hydroxypropyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[(2S)-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 83029637 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[(2S)-2-hydroxypropyl]acetamide |
| SMILES | C[C@H](O)CNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO2S/c1-7(15)5-14-11(16)6-17-10-4-8(12)2-3-9(10)13/h2-4,7,15H,5-6H2,1H3,(H,14,16)/t7-/m0/s1 |
| InChIKey | MPVAYSJMHCCQMB-ZETCQYMHSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |