C12H15Cl2NO2S — CID 43390208
2-(2,5-dichlorophenyl)sulfanyl-N-(1-hydroxybutan-2-yl)acetamide (PubChem CID 43390208) has the molecular formula C12H15Cl2NO2S and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(1-hydroxybutan-2-yl)acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(1-hydroxybutan-2-yl)acetamide |
|---|---|
| PubChem CID | 43390208 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(1-hydroxybutan-2-yl)acetamide |
| SMILES | CCC(CO)NC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO2S/c1-2-9(6-16)15-12(17)7-18-11-5-8(13)3-4-10(11)14/h3-5,9,16H,2,6-7H2,1H3,(H,15,17) |
| InChIKey | ZJIZBUGWGWLTSQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |