C12H14Cl2O2S2 — CID 64915120
3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoic acid (PubChem CID 64915120) has the molecular formula C12H14Cl2O2S2 and a molecular weight of 325.28 g/mol. Its IUPAC name is 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64915120 |
| Molecular Formula | C12H14Cl2O2S2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-2-methylpropanoic acid |
| SMILES | CC(CSCCSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14Cl2O2S2/c1-8(12(15)16)7-17-4-5-18-11-6-9(13)2-3-10(11)14/h2-3,6,8H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | UVUZFVKIWHIIQQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|