C11H15Cl2NS — CID 61386021
3-(2,5-dichlorophenyl)sulfanyl-N-ethylpropan-1-amine (PubChem CID 61386021) has the molecular formula C11H15Cl2NS and a molecular weight of 264.22 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)sulfanyl-N-ethylpropan-1-amine.
| Compound Name | 3-(2,5-dichlorophenyl)sulfanyl-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 61386021 |
| Molecular Formula | C11H15Cl2NS |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 3-(2,5-dichlorophenyl)sulfanyl-N-ethylpropan-1-amine |
| SMILES | CCNCCCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2NS/c1-2-14-6-3-7-15-11-8-9(12)4-5-10(11)13/h4-5,8,14H,2-3,6-7H2,1H3 |
| InChIKey | QGOJCTGNQPZLTF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|