C14H21Cl2NOS — CID 63517902
2-butoxy-N-[2-(2,5-dichlorophenyl)sulfanylethyl]ethanamine (PubChem CID 63517902) has the molecular formula C14H21Cl2NOS and a molecular weight of 322.30 g/mol. Its IUPAC name is 2-butoxy-N-[2-(2,5-dichlorophenyl)sulfanylethyl]ethanamine.
| Compound Name | 2-butoxy-N-[2-(2,5-dichlorophenyl)sulfanylethyl]ethanamine |
|---|---|
| PubChem CID | 63517902 |
| Molecular Formula | C14H21Cl2NOS |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-butoxy-N-[2-(2,5-dichlorophenyl)sulfanylethyl]ethanamine |
| SMILES | CCCCOCCNCCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H21Cl2NOS/c1-2-3-8-18-9-6-17-7-10-19-14-11-12(15)4-5-13(14)16/h4-5,11,17H,2-3,6-10H2,1H3 |
| InChIKey | LOAKMTXREOIPJS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|