C12H15ClFNO2 — CID 81145005
2-[(3-chloro-4-fluorophenyl)methylamino]-3-methylbutanoic acid (PubChem CID 81145005) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methylamino]-3-methylbutanoic acid.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81145005 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NCc1ccc(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H15ClFNO2/c1-7(2)11(12(16)17)15-6-8-3-4-10(14)9(13)5-8/h3-5,7,11,15H,6H2,1-2H3,(H,16,17) |
| InChIKey | PCMAJQGNWWCSGK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |