C12H16ClFIN — CID 107859379
N-[(3-chloro-4-fluorophenyl)methyl]-1-iodo-3-methylbutan-2-amine (PubChem CID 107859379) has the molecular formula C12H16ClFIN and a molecular weight of 355.62 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1-iodo-3-methylbutan-2-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-iodo-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 107859379 |
| Molecular Formula | C12H16ClFIN |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-iodo-3-methylbutan-2-amine |
| SMILES | CC(C)C(CI)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClFIN/c1-8(2)12(6-15)16-7-9-3-4-11(14)10(13)5-9/h3-5,8,12,16H,6-7H2,1-2H3 |
| InChIKey | PJAVDPUZEZRGKA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|