C14H21ClFN — CID 103039834
1-(3-chloro-4-fluorophenyl)-3-methyl-N-propylbutan-2-amine (PubChem CID 103039834) has the molecular formula C14H21ClFN and a molecular weight of 257.78 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-methyl-N-propylbutan-2-amine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-methyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 103039834 |
| Molecular Formula | C14H21ClFN |
| Molecular Weight | 257.78 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-methyl-N-propylbutan-2-amine |
| SMILES | CCCNC(Cc1ccc(F)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C14H21ClFN/c1-4-7-17-14(10(2)3)9-11-5-6-13(16)12(15)8-11/h5-6,8,10,14,17H,4,7,9H2,1-3H3 |
| InChIKey | DIDDTTCAPUTVBW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |