C18H29ClFN — CID 107891790
1-(4-chloro-3-fluorophenyl)-N,3-dipropylhexan-2-amine (PubChem CID 107891790) has the molecular formula C18H29ClFN and a molecular weight of 313.89 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N,3-dipropylhexan-2-amine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N,3-dipropylhexan-2-amine |
|---|---|
| PubChem CID | 107891790 |
| Molecular Formula | C18H29ClFN |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N,3-dipropylhexan-2-amine |
| SMILES | CCCNC(Cc1ccc(Cl)c(F)c1)C(CCC)CCC |
| InChI | InChI=1S/C18H29ClFN/c1-4-7-15(8-5-2)18(21-11-6-3)13-14-9-10-16(19)17(20)12-14/h9-10,12,15,18,21H,4-8,11,13H2,1-3H3 |
| InChIKey | RMNNUQWPWPPTGY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |