C19H33N — CID 82987030
1-(4-methylphenyl)-N,3-dipropylhexan-2-amine (PubChem CID 82987030) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N,3-dipropylhexan-2-amine.
| Compound Name | 1-(4-methylphenyl)-N,3-dipropylhexan-2-amine |
|---|---|
| PubChem CID | 82987030 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 1-(4-methylphenyl)-N,3-dipropylhexan-2-amine |
| SMILES | CCCNC(Cc1ccc(C)cc1)C(CCC)CCC |
| InChI | InChI=1S/C19H33N/c1-5-8-18(9-6-2)19(20-14-7-3)15-17-12-10-16(4)11-13-17/h10-13,18-20H,5-9,14-15H2,1-4H3 |
| InChIKey | PDGOYDXMQGFELT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |