C18H30ClN — CID 82986931
1-(2-chlorophenyl)-N,3-dipropylhexan-2-amine (PubChem CID 82986931) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,3-dipropylhexan-2-amine.
| Compound Name | 1-(2-chlorophenyl)-N,3-dipropylhexan-2-amine |
|---|---|
| PubChem CID | 82986931 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-(2-chlorophenyl)-N,3-dipropylhexan-2-amine |
| SMILES | CCCNC(Cc1ccccc1Cl)C(CCC)CCC |
| InChI | InChI=1S/C18H30ClN/c1-4-9-15(10-5-2)18(20-13-6-3)14-16-11-7-8-12-17(16)19/h7-8,11-12,15,18,20H,4-6,9-10,13-14H2,1-3H3 |
| InChIKey | JKAQZZYPYNJWCF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |