C17H27ClFN — CID 102867344
1-(3-chloro-2-fluorophenyl)-N-ethyl-3-propylhexan-2-amine (PubChem CID 102867344) has the molecular formula C17H27ClFN and a molecular weight of 299.86 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-N-ethyl-3-propylhexan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-N-ethyl-3-propylhexan-2-amine |
|---|---|
| PubChem CID | 102867344 |
| Molecular Formula | C17H27ClFN |
| Molecular Weight | 299.86 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-N-ethyl-3-propylhexan-2-amine |
| SMILES | CCCC(CCC)C(Cc1cccc(Cl)c1F)NCC |
| InChI | InChI=1S/C17H27ClFN/c1-4-8-13(9-5-2)16(20-6-3)12-14-10-7-11-15(18)17(14)19/h7,10-11,13,16,20H,4-6,8-9,12H2,1-3H3 |
| InChIKey | GAPJLYWLPJMZOX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |