C17H21ClFNO — CID 107892231
N-[2-(4-chloro-3-fluorophenyl)-1-(5-ethylfuran-2-yl)ethyl]propan-1-amine (PubChem CID 107892231) has the molecular formula C17H21ClFNO and a molecular weight of 309.81 g/mol. Its IUPAC name is N-[2-(4-chloro-3-fluorophenyl)-1-(5-ethylfuran-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-chloro-3-fluorophenyl)-1-(5-ethylfuran-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107892231 |
| Molecular Formula | C17H21ClFNO |
| Molecular Weight | 309.81 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[2-(4-chloro-3-fluorophenyl)-1-(5-ethylfuran-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)c(F)c1)c1ccc(CC)o1 |
| InChI | InChI=1S/C17H21ClFNO/c1-3-9-20-16(17-8-6-13(4-2)21-17)11-12-5-7-14(18)15(19)10-12/h5-8,10,16,20H,3-4,9,11H2,1-2H3 |
| InChIKey | GKYNDTHHZYFXLE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |