C16H19ClFNO — CID 107891629
N-[2-(4-chloro-3-fluorophenyl)-1-(5-methylfuran-3-yl)ethyl]propan-1-amine (PubChem CID 107891629) has the molecular formula C16H19ClFNO and a molecular weight of 295.79 g/mol. Its IUPAC name is N-[2-(4-chloro-3-fluorophenyl)-1-(5-methylfuran-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-chloro-3-fluorophenyl)-1-(5-methylfuran-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107891629 |
| Molecular Formula | C16H19ClFNO |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[2-(4-chloro-3-fluorophenyl)-1-(5-methylfuran-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)c(F)c1)c1coc(C)c1 |
| InChI | InChI=1S/C16H19ClFNO/c1-3-6-19-16(13-7-11(2)20-10-13)9-12-4-5-14(17)15(18)8-12/h4-5,7-8,10,16,19H,3,6,9H2,1-2H3 |
| InChIKey | QTLYLOFCBHVCLR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |