C17H27Cl2NO — CID 116718299
1-(3,4-dichlorophenyl)-3-ethoxy-N-propylhexan-2-amine (PubChem CID 116718299) has the molecular formula C17H27Cl2NO and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-ethoxy-N-propylhexan-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-3-ethoxy-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 116718299 |
| Molecular Formula | C17H27Cl2NO |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-ethoxy-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1ccc(Cl)c(Cl)c1)C(CCC)OCC |
| InChI | InChI=1S/C17H27Cl2NO/c1-4-7-17(21-6-3)16(20-10-5-2)12-13-8-9-14(18)15(19)11-13/h8-9,11,16-17,20H,4-7,10,12H2,1-3H3 |
| InChIKey | PLXVTSZJHYBTQA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |