C12H16Cl2IN — CID 107859422
N-[(2,5-dichlorophenyl)methyl]-1-iodo-3-methylbutan-2-amine (PubChem CID 107859422) has the molecular formula C12H16Cl2IN and a molecular weight of 372.08 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-1-iodo-3-methylbutan-2-amine.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-1-iodo-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 107859422 |
| Molecular Formula | C12H16Cl2IN |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-1-iodo-3-methylbutan-2-amine |
| SMILES | CC(C)C(CI)NCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H16Cl2IN/c1-8(2)12(6-15)16-7-9-5-10(13)3-4-11(9)14/h3-5,8,12,16H,6-7H2,1-2H3 |
| InChIKey | KMRVCKBVKQRBPN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|