C12H16Cl2FN — CID 103041364
5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pentan-2-amine (PubChem CID 103041364) has the molecular formula C12H16Cl2FN and a molecular weight of 264.17 g/mol. Its IUPAC name is 5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pentan-2-amine.
| Compound Name | 5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pentan-2-amine |
|---|---|
| PubChem CID | 103041364 |
| Molecular Formula | C12H16Cl2FN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pentan-2-amine |
| SMILES | CC(CCCCl)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2FN/c1-9(3-2-6-13)16-8-10-4-5-12(15)11(14)7-10/h4-5,7,9,16H,2-3,6,8H2,1H3 |
| InChIKey | RDXGGEGNTRCQHO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|